Name | 3-(2-Bromo-Phenyl)-Propionaldehyde |
Synonyms | 2-Bromobenzenepropanal 4-(2-broMophenyl)butanal 3-(2-Bromphenyl)propanal Benzenepropanal, 2-broMo- benzenepropanal, 2-bromo- 3-(2-bromophenyl)propanal 3-(2-BROMO-PHENYL)-PROPIONALDEHYDE 3-(2-Bromo-Phenyl)-Propionaldehyde |
CAS | 107408-16-2 |
InChI | InChI=1/C9H9BrO/c10-9-6-2-1-4-8(9)5-3-7-11/h1-2,4,6-7H,3,5H2 |
Molecular Formula | C9H9BrO |
Molar Mass | 213.07 |
Density | 1.399±0.06 g/cm3(Predicted) |
Boling Point | 95-105 °C(Press: 0.1-0.2 Torr) |
Flash Point | 73.92°C |
Vapor Presure | 0.011mmHg at 25°C |
Refractive Index | 1.547 |
Use | O-bromophenylpropanal can be used as a pharmaceutical synthesis intermediate. If inhalation of O-bromophenylpropanal, move the patient to fresh air; If skin contact, should remove contaminated clothing, thoroughly rinse the skin with soap water and water, if there is discomfort, see a doctor; |